C22H27N3O4 — CID 24577053
(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-[2-(cyclohexen-1-yl)ethylamino]benzoate (PubChem CID 24577053) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-[2-(cyclohexen-1-yl)ethylamino]benzoate.
| Compound Name | (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-[2-(cyclohexen-1-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 24577053 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl 2-[2-(cyclohexen-1-yl)ethylamino]benzoate |
| SMILES | Cn1c(COC(=O)c2ccccc2NCCC2=CCCCC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C22H27N3O4/c1-24-17(14-20(26)25(2)22(24)28)15-29-21(27)18-10-6-7-11-19(18)23-13-12-16-8-4-3-5-9-16/h6-8,10-11,14,23H,3-5,9,12-13,15H2,1-2H3 |
| InChIKey | VLWYKNVLDPGZHT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|