C20H28N4O3 — CID 26652596
N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-[(1R)-1-phenylethyl]amino]acetamide (PubChem CID 26652596) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-[(1R)-1-phenylethyl]amino]acetamide.
| Compound Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-[(1R)-1-phenylethyl]amino]acetamide |
|---|---|
| PubChem CID | 26652596 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-[(1R)-1-phenylethyl]amino]acetamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)CN(C)[C@H](C)c1ccccc1)C2=O |
| InChI | InChI=1S/C20H28N4O3/c1-14-9-11-20(12-10-14)18(26)24(19(27)21-20)22-17(25)13-23(3)15(2)16-7-5-4-6-8-16/h4-8,14-15H,9-13H2,1-3H3,(H,21,27)(H,22,25)/t14?,15-,20?/m1/s1 |
| InChIKey | KINFNAGDIUBNPA-RDYUPDBUSA-N |
| XLogP | 2.21 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|