C18H23N3O3S — CID 40810140
(2S)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-phenylsulfanylpropanamide (PubChem CID 40810140) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is (2S)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-phenylsulfanylpropanamide.
| Compound Name | (2S)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 40810140 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (2S)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-phenylsulfanylpropanamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)[C@H](C)Sc1ccccc1)C2=O |
| InChI | InChI=1S/C18H23N3O3S/c1-12-8-10-18(11-9-12)16(23)21(17(24)19-18)20-15(22)13(2)25-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H,19,24)(H,20,22)/t12?,13-,18?/m0/s1 |
| InChIKey | JNKFFOCGAMRDDQ-XYEKJYRLSA-N |
| XLogP | 2.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|