C19H30N2OS — CID 86990920
N-[4-(4-methylpiperidin-1-yl)butyl]-2-phenylsulfanylpropanamide (PubChem CID 86990920) has the molecular formula C19H30N2OS and a molecular weight of 334.53 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)butyl]-2-phenylsulfanylpropanamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)butyl]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 86990920 |
| Molecular Formula | C19H30N2OS |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)butyl]-2-phenylsulfanylpropanamide |
| SMILES | CC1CCN(CCCCNC(=O)C(C)Sc2ccccc2)CC1 |
| InChI | InChI=1S/C19H30N2OS/c1-16-10-14-21(15-11-16)13-7-6-12-20-19(22)17(2)23-18-8-4-3-5-9-18/h3-5,8-9,16-17H,6-7,10-15H2,1-2H3,(H,20,22) |
| InChIKey | GTGDWOBVRGIOJZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|