C21H26N2O4S3 — CID 95354875
(2R)-2-phenylsulfanyl-N-[3-[[(2R)-2-phenylsulfanylpropanoyl]sulfamoyl]propyl]propanamide (PubChem CID 95354875) has the molecular formula C21H26N2O4S3 and a molecular weight of 466.65 g/mol. Its IUPAC name is (2R)-2-phenylsulfanyl-N-[3-[[(2R)-2-phenylsulfanylpropanoyl]sulfamoyl]propyl]propanamide.
| Compound Name | (2R)-2-phenylsulfanyl-N-[3-[[(2R)-2-phenylsulfanylpropanoyl]sulfamoyl]propyl]propanamide |
|---|---|
| PubChem CID | 95354875 |
| Molecular Formula | C21H26N2O4S3 |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (2R)-2-phenylsulfanyl-N-[3-[[(2R)-2-phenylsulfanylpropanoyl]sulfamoyl]propyl]propanamide |
| SMILES | C[C@@H](Sc1ccccc1)C(=O)NCCCS(=O)(=O)NC(=O)[C@@H](C)Sc1ccccc1 |
| InChI | InChI=1S/C21H26N2O4S3/c1-16(28-18-10-5-3-6-11-18)20(24)22-14-9-15-30(26,27)23-21(25)17(2)29-19-12-7-4-8-13-19/h3-8,10-13,16-17H,9,14-15H2,1-2H3,(H,22,24)(H,23,25)/t16-,17-/m1/s1 |
| InChIKey | FXOBACKGRHTNJW-IAGOWNOFSA-N |
| XLogP | 3.30 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|