C14H21NO4S2 — CID 94190179
(2R)-N-butylsulfonyl-2-(4-methoxyphenyl)sulfanylpropanamide (PubChem CID 94190179) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (2R)-N-butylsulfonyl-2-(4-methoxyphenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-butylsulfonyl-2-(4-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 94190179 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (2R)-N-butylsulfonyl-2-(4-methoxyphenyl)sulfanylpropanamide |
| SMILES | CCCCS(=O)(=O)NC(=O)[C@@H](C)Sc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H21NO4S2/c1-4-5-10-21(17,18)15-14(16)11(2)20-13-8-6-12(19-3)7-9-13/h6-9,11H,4-5,10H2,1-3H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | ZMCDYBLBZJVFIN-LLVKDONJSA-N |
| XLogP | 2.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |