C20H34N4 — CID 111135431
2-methyl-1-[4-(4-methylpiperidin-1-yl)butyl]-3-(2-phenylethyl)guanidine (PubChem CID 111135431) has the molecular formula C20H34N4 and a molecular weight of 330.52 g/mol. Its IUPAC name is 2-methyl-1-[4-(4-methylpiperidin-1-yl)butyl]-3-(2-phenylethyl)guanidine.
| Compound Name | 2-methyl-1-[4-(4-methylpiperidin-1-yl)butyl]-3-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111135431 |
| Molecular Formula | C20H34N4 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | 2-methyl-1-[4-(4-methylpiperidin-1-yl)butyl]-3-(2-phenylethyl)guanidine |
| SMILES | C/N=C(/NCCCCN1CCC(C)CC1)NCCc1ccccc1 |
| InChI | InChI=1S/C20H34N4/c1-18-11-16-24(17-12-18)15-7-6-13-22-20(21-2)23-14-10-19-8-4-3-5-9-19/h3-5,8-9,18H,6-7,10-17H2,1-2H3,(H2,21,22,23) |
| InChIKey | HVUIAPDLPIUPRM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|