C18H31N5O2 — CID 111386974
N-[2-[[N'-methyl-N-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 111386974) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[2-[[N'-methyl-N-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[N'-methyl-N-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111386974 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | N-[2-[[N'-methyl-N-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | C/N=C(/NCCCN1CCC(C)CC1)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C18H31N5O2/c1-15-6-12-23(13-7-15)11-4-8-21-18(19-2)22-10-9-20-17(24)16-5-3-14-25-16/h3,5,14-15H,4,6-13H2,1-2H3,(H,20,24)(H2,19,21,22) |
| InChIKey | KQBMZHMVYBPLBP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|