C21H30N4O3 — CID 9132494
N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[(1R)-2-methyl-1-phenylpropyl]amino]acetamide (PubChem CID 9132494) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[(1R)-2-methyl-1-phenylpropyl]amino]acetamide.
| Compound Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[(1R)-2-methyl-1-phenylpropyl]amino]acetamide |
|---|---|
| PubChem CID | 9132494 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[(1R)-2-methyl-1-phenylpropyl]amino]acetamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)CN[C@@H](c1ccccc1)C(C)C)C2=O |
| InChI | InChI=1S/C21H30N4O3/c1-14(2)18(16-7-5-4-6-8-16)22-13-17(26)24-25-19(27)21(23-20(25)28)11-9-15(3)10-12-21/h4-8,14-15,18,22H,9-13H2,1-3H3,(H,23,28)(H,24,26)/t15?,18-,21?/m1/s1 |
| InChIKey | NSGMULKVFHNBGK-BPVAQJAMSA-N |
| XLogP | 2.51 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|