C23H32N4O3 — CID 45281463
N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]acetamide (PubChem CID 45281463) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]acetamide.
| Compound Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 45281463 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]acetamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)CNC(C)c1ccc3c(c1)CCCC3)C2=O |
| InChI | InChI=1S/C23H32N4O3/c1-15-9-11-23(12-10-15)21(29)27(22(30)25-23)26-20(28)14-24-16(2)18-8-7-17-5-3-4-6-19(17)13-18/h7-8,13,15-16,24H,3-6,9-12,14H2,1-2H3,(H,25,30)(H,26,28) |
| InChIKey | YRQWNDKKUBZZMB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|