C26H31N3O2 — CID 167892371
3-[3-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]methyl]phenyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 167892371) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-[3-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]methyl]phenyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[3-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]methyl]phenyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 167892371 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 3-[3-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]methyl]phenyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC(NCc1cccc(N2C(=O)NC3(CCCC3)C2=O)c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C26H31N3O2/c1-18(21-12-11-20-8-2-3-9-22(20)16-21)27-17-19-7-6-10-23(15-19)29-24(30)26(28-25(29)31)13-4-5-14-26/h6-7,10-12,15-16,18,27H,2-5,8-9,13-14,17H2,1H3,(H,28,31) |
| InChIKey | LPPQGVNWBYGOTI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|