C12H13N3O2 — CID 80578964
6-[3-(aminomethyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 80578964) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 6-[3-(aminomethyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione.
| Compound Name | 6-[3-(aminomethyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
|---|---|
| PubChem CID | 80578964 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 6-[3-(aminomethyl)phenyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | NCc1cccc(N2C(=O)NC3(CC3)C2=O)c1 |
| InChI | InChI=1S/C12H13N3O2/c13-7-8-2-1-3-9(6-8)15-10(16)12(4-5-12)14-11(15)17/h1-3,6H,4-5,7,13H2,(H,14,17) |
| InChIKey | AFZLKLONYDCPQB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|