C20H29N5O5S — CID 16566298
N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide (PubChem CID 16566298) has the molecular formula C20H29N5O5S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide.
| Compound Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 16566298 |
| Molecular Formula | C20H29N5O5S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)CN(C)C(C)c1ccc(S(N)(=O)=O)cc1)C2=O |
| InChI | InChI=1S/C20H29N5O5S/c1-13-8-10-20(11-9-13)18(27)25(19(28)22-20)23-17(26)12-24(3)14(2)15-4-6-16(7-5-15)31(21,29)30/h4-7,13-14H,8-12H2,1-3H3,(H,22,28)(H,23,26)(H2,21,29,30) |
| InChIKey | AXNNVFBZQVRQDW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|