C23H32N4O3S — CID 40792110
N-[4-(azepan-1-yl)phenyl]-2-[methyl-[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]acetamide (PubChem CID 40792110) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-2-[methyl-[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]acetamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-2-[methyl-[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 40792110 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-2-[methyl-[(1S)-1-(4-sulfamoylphenyl)ethyl]amino]acetamide |
| SMILES | C[C@@H](c1ccc(S(N)(=O)=O)cc1)N(C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C23H32N4O3S/c1-18(19-7-13-22(14-8-19)31(24,29)30)26(2)17-23(28)25-20-9-11-21(12-10-20)27-15-5-3-4-6-16-27/h7-14,18H,3-6,15-17H2,1-2H3,(H,25,28)(H2,24,29,30)/t18-/m0/s1 |
| InChIKey | SUHSUKXRTDBRNU-SFHVURJKSA-N |
| XLogP | 3.35 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|