C17H20IN3O3S — CID 46809997
N-(3-iodophenyl)-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide (PubChem CID 46809997) has the molecular formula C17H20IN3O3S and a molecular weight of 473.34 g/mol. Its IUPAC name is N-(3-iodophenyl)-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide.
| Compound Name | N-(3-iodophenyl)-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 46809997 |
| Molecular Formula | C17H20IN3O3S |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | N-(3-iodophenyl)-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide |
| SMILES | CC(c1ccc(S(N)(=O)=O)cc1)N(C)CC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C17H20IN3O3S/c1-12(13-6-8-16(9-7-13)25(19,23)24)21(2)11-17(22)20-15-5-3-4-14(18)10-15/h3-10,12H,11H2,1-2H3,(H,20,22)(H2,19,23,24) |
| InChIKey | PGJFPRLWSACAFZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|