C16H26N4O3S — CID 110606260
N-(4-piperidin-1-ylphenyl)-2-(propan-2-ylsulfamoylamino)acetamide (PubChem CID 110606260) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-2-(propan-2-ylsulfamoylamino)acetamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)-2-(propan-2-ylsulfamoylamino)acetamide |
|---|---|
| PubChem CID | 110606260 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-2-(propan-2-ylsulfamoylamino)acetamide |
| SMILES | CC(C)NS(=O)(=O)NCC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C16H26N4O3S/c1-13(2)19-24(22,23)17-12-16(21)18-14-6-8-15(9-7-14)20-10-4-3-5-11-20/h6-9,13,17,19H,3-5,10-12H2,1-2H3,(H,18,21) |
| InChIKey | FPGARFYEWOTLGB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|