C16H27N5O3S — CID 110606284
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(propan-2-ylsulfamoylamino)acetamide (PubChem CID 110606284) has the molecular formula C16H27N5O3S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(propan-2-ylsulfamoylamino)acetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(propan-2-ylsulfamoylamino)acetamide |
|---|---|
| PubChem CID | 110606284 |
| Molecular Formula | C16H27N5O3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(propan-2-ylsulfamoylamino)acetamide |
| SMILES | CC(C)NS(=O)(=O)NCC(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C16H27N5O3S/c1-13(2)19-25(23,24)17-12-16(22)18-14-4-6-15(7-5-14)21-10-8-20(3)9-11-21/h4-7,13,17,19H,8-12H2,1-3H3,(H,18,22) |
| InChIKey | IVUZREDFKZDKSR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|