C21H25F2N3O — CID 8593623
2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 8593623) has the molecular formula C21H25F2N3O and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 8593623 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | C[C@H](NCC(=O)Nc1ccc(N2CCCCC2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H25F2N3O/c1-15(19-10-5-16(22)13-20(19)23)24-14-21(27)25-17-6-8-18(9-7-17)26-11-3-2-4-12-26/h5-10,13,15,24H,2-4,11-12,14H2,1H3,(H,25,27)/t15-/m0/s1 |
| InChIKey | PJOXNYNNBOSZQR-HNNXBMFYSA-N |
| XLogP | 4.24 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|