C24H30N6O — CID 78807265
2-[methyl-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]amino]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 78807265) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 2-[methyl-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]amino]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[methyl-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]amino]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 78807265 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-[methyl-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]amino]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CC(c1ccc(-n2cncn2)cc1)N(C)CC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H30N6O/c1-19(20-6-10-23(11-7-20)30-18-25-17-26-30)28(2)16-24(31)27-21-8-12-22(13-9-21)29-14-4-3-5-15-29/h6-13,17-19H,3-5,14-16H2,1-2H3,(H,27,31) |
| InChIKey | RSVNSCUWAOPJRC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|