C23H25N5O3 — CID 9483561
[2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 9483561) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate.
| Compound Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 9483561 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(-n2cncn2)cc1)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C23H25N5O3/c29-22(26-19-7-11-20(12-8-19)27-13-3-1-2-4-14-27)15-31-23(30)18-5-9-21(10-6-18)28-17-24-16-25-28/h5-12,16-17H,1-4,13-15H2,(H,26,29) |
| InChIKey | RLAQJALQHYQLRA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|