C20H28N4O5S — CID 45355784
N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(4-methylsulfonylphenyl)ethylamino]acetamide (PubChem CID 45355784) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(4-methylsulfonylphenyl)ethylamino]acetamide.
| Compound Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(4-methylsulfonylphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 45355784 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(4-methylsulfonylphenyl)ethylamino]acetamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)CNC(C)c1ccc(S(C)(=O)=O)cc1)C2=O |
| InChI | InChI=1S/C20H28N4O5S/c1-13-8-10-20(11-9-13)18(26)24(19(27)22-20)23-17(25)12-21-14(2)15-4-6-16(7-5-15)30(3,28)29/h4-7,13-14,21H,8-12H2,1-3H3,(H,22,27)(H,23,25) |
| InChIKey | YMVOKXQNZBZBCF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|