C20H29N4O3+ — CID 9132337
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium (PubChem CID 9132337) has the molecular formula C20H29N4O3+ and a molecular weight of 373.48 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium |
|---|---|
| PubChem CID | 9132337 |
| Molecular Formula | C20H29N4O3+ |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+]CC(=O)NN1C(=O)NC2(CCCCC2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C20H28N4O3/c1-14(2)17(15-9-5-3-6-10-15)21-13-16(25)23-24-18(26)20(22-19(24)27)11-7-4-8-12-20/h3,5-6,9-10,14,17,21H,4,7-8,11-13H2,1-2H3,(H,22,27)(H,23,25)/p+1/t17-/m1/s1 |
| InChIKey | UQUXIPRBCHEZCW-QGZVFWFLSA-O |
| XLogP | 1.23 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|