C23H29N4O3+ — CID 9133156
[2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium (PubChem CID 9133156) has the molecular formula C23H29N4O3+ and a molecular weight of 409.51 g/mol. Its IUPAC name is [2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium.
| Compound Name | [2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium |
|---|---|
| PubChem CID | 9133156 |
| Molecular Formula | C23H29N4O3+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | [2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(NC(=O)C[NH2+][C@H](c2ccccc2)C(C)C)C1=O |
| InChI | InChI=1S/C23H28N4O3/c1-4-23(18-13-9-6-10-14-18)21(29)27(22(30)25-23)26-19(28)15-24-20(16(2)3)17-11-7-5-8-12-17/h5-14,16,20,24H,4,15H2,1-3H3,(H,25,30)(H,26,28)/p+1/t20-,23+/m0/s1 |
| InChIKey | PDFMLZMGCSIADA-NZQKXSOJSA-O |
| XLogP | 1.84 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|