C22H31N5O4 — CID 55851050
N-[1-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]piperidin-4-yl]-2-methylpropanamide (PubChem CID 55851050) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[1-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]piperidin-4-yl]-2-methylpropanamide.
| Compound Name | N-[1-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]piperidin-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 55851050 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[1-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]piperidin-4-yl]-2-methylpropanamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(NC(=O)CN2CCC(NC(=O)C(C)C)CC2)C1=O |
| InChI | InChI=1S/C22H31N5O4/c1-4-22(16-8-6-5-7-9-16)20(30)27(21(31)24-22)25-18(28)14-26-12-10-17(11-13-26)23-19(29)15(2)3/h5-9,15,17H,4,10-14H2,1-3H3,(H,23,29)(H,24,31)(H,25,28) |
| InChIKey | OVINCHPXZDHHQY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|