C19H25N3O3 — CID 9293678
3-cyclopentyl-N-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]propanamide (PubChem CID 9293678) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-cyclopentyl-N-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]propanamide.
| Compound Name | 3-cyclopentyl-N-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 9293678 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-cyclopentyl-N-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]propanamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(NC(=O)CCC2CCCC2)C1=O |
| InChI | InChI=1S/C19H25N3O3/c1-2-19(15-10-4-3-5-11-15)17(24)22(18(25)20-19)21-16(23)13-12-14-8-6-7-9-14/h3-5,10-11,14H,2,6-9,12-13H2,1H3,(H,20,25)(H,21,23)/t19-/m1/s1 |
| InChIKey | HFWCCWZMQVOFKQ-LJQANCHMSA-N |
| XLogP | 2.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|