C20H28N4O3 — CID 25435064
2-(azocan-1-yl)-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide (PubChem CID 25435064) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-(azocan-1-yl)-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide.
| Compound Name | 2-(azocan-1-yl)-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 25435064 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-(azocan-1-yl)-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(NC(=O)CN2CCCCCCC2)C1=O |
| InChI | InChI=1S/C20H28N4O3/c1-2-20(16-11-7-6-8-12-16)18(26)24(19(27)21-20)22-17(25)15-23-13-9-4-3-5-10-14-23/h6-8,11-12H,2-5,9-10,13-15H2,1H3,(H,21,27)(H,22,25)/t20-/m0/s1 |
| InChIKey | AMBNTKSUBAWEGU-FQEVSTJZSA-N |
| XLogP | 2.14 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|