C22H27N4O3+ — CID 8564244
benzyl-ethyl-[2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]azanium (PubChem CID 8564244) has the molecular formula C22H27N4O3+ and a molecular weight of 395.48 g/mol. Its IUPAC name is benzyl-ethyl-[2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]azanium.
| Compound Name | benzyl-ethyl-[2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8564244 |
| Molecular Formula | C22H27N4O3+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | benzyl-ethyl-[2-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]amino]-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC(=O)NN1C(=O)N[C@](CC)(c2ccccc2)C1=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H26N4O3/c1-3-22(18-13-9-6-10-14-18)20(28)26(21(29)23-22)24-19(27)16-25(4-2)15-17-11-7-5-8-12-17/h5-14H,3-4,15-16H2,1-2H3,(H,23,29)(H,24,27)/p+1/t22-/m1/s1 |
| InChIKey | GFXBWBZVJFJBHD-JOCHJYFZSA-O |
| XLogP | 0.98 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|