C18H17BrN4O5 — CID 24549185
5-bromo-N-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 24549185) has the molecular formula C18H17BrN4O5 and a molecular weight of 449.26 g/mol. Its IUPAC name is 5-bromo-N-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24549185 |
| Molecular Formula | C18H17BrN4O5 |
| Molecular Weight | 449.26 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 5-bromo-N-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(NC(=O)CNC(=O)c2ccc(Br)o2)C1=O |
| InChI | InChI=1S/C18H17BrN4O5/c1-2-18(11-6-4-3-5-7-11)16(26)23(17(27)21-18)22-14(24)10-20-15(25)12-8-9-13(19)28-12/h3-9H,2,10H2,1H3,(H,20,25)(H,21,27)(H,22,24) |
| InChIKey | GHJPNPUWKMJKIO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|