C22H24N4O4 — CID 24549178
N-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]-3,5-dimethylbenzamide (PubChem CID 24549178) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]-3,5-dimethylbenzamide.
| Compound Name | N-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 24549178 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[2-[(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)amino]-2-oxoethyl]-3,5-dimethylbenzamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(NC(=O)CNC(=O)c2cc(C)cc(C)c2)C1=O |
| InChI | InChI=1S/C22H24N4O4/c1-4-22(17-8-6-5-7-9-17)20(29)26(21(30)24-22)25-18(27)13-23-19(28)16-11-14(2)10-15(3)12-16/h5-12H,4,13H2,1-3H3,(H,23,28)(H,24,30)(H,25,27) |
| InChIKey | JYIGXPXPXJPATQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|