C16H15N3O3S — CID 9294715
N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiophene-3-carboxamide (PubChem CID 9294715) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiophene-3-carboxamide.
| Compound Name | N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 9294715 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiophene-3-carboxamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(NC(=O)c2ccsc2)C1=O |
| InChI | InChI=1S/C16H15N3O3S/c1-2-16(12-6-4-3-5-7-12)14(21)19(15(22)17-16)18-13(20)11-8-9-23-10-11/h3-10H,2H2,1H3,(H,17,22)(H,18,20)/t16-/m0/s1 |
| InChIKey | CGCQPZLSCVEPFS-INIZCTEOSA-N |
| XLogP | 2.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|