C26H23N5O3 — CID 41023589
N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2-methyl-1-phenylbenzimidazole-5-carboxamide (PubChem CID 41023589) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2-methyl-1-phenylbenzimidazole-5-carboxamide.
| Compound Name | N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2-methyl-1-phenylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 41023589 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2-methyl-1-phenylbenzimidazole-5-carboxamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(NC(=O)c2ccc3c(c2)nc(C)n3-c2ccccc2)C1=O |
| InChI | InChI=1S/C26H23N5O3/c1-3-26(19-10-6-4-7-11-19)24(33)31(25(34)28-26)29-23(32)18-14-15-22-21(16-18)27-17(2)30(22)20-12-8-5-9-13-20/h4-16H,3H2,1-2H3,(H,28,34)(H,29,32)/t26-/m0/s1 |
| InChIKey | JQBOMACYCXQNRH-SANMLTNESA-N |
| XLogP | 3.84 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|