C20H18N4O3 — CID 9294420
N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-1H-indole-2-carboxamide (PubChem CID 9294420) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 9294420 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-1H-indole-2-carboxamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(NC(=O)c2cc3ccccc3[nH]2)C1=O |
| InChI | InChI=1S/C20H18N4O3/c1-2-20(14-9-4-3-5-10-14)18(26)24(19(27)22-20)23-17(25)16-12-13-8-6-7-11-15(13)21-16/h3-12,21H,2H2,1H3,(H,22,27)(H,23,25)/t20-/m0/s1 |
| InChIKey | OAOWMJDGZXMOSD-FQEVSTJZSA-N |
| XLogP | 2.67 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|