C19H23N7O3S — CID 41099363
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide (PubChem CID 41099363) has the molecular formula C19H23N7O3S and a molecular weight of 429.51 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 41099363 |
| Molecular Formula | C19H23N7O3S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(NC(=O)CSc2nnnn2C2CCCC2)C1=O |
| InChI | InChI=1S/C19H23N7O3S/c1-2-19(13-8-4-3-5-9-13)16(28)26(17(29)20-19)22-15(27)12-30-18-21-23-24-25(18)14-10-6-7-11-14/h3-5,8-9,14H,2,6-7,10-12H2,1H3,(H,20,29)(H,22,27)/t19-/m0/s1 |
| InChIKey | FLSRAAFPHIHKHR-IBGZPJMESA-N |
| XLogP | 1.77 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|