C18H23N5OS — CID 35493834
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[(1-phenylcyclopentyl)methyl]acetamide (PubChem CID 35493834) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[(1-phenylcyclopentyl)methyl]acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[(1-phenylcyclopentyl)methyl]acetamide |
|---|---|
| PubChem CID | 35493834 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[(1-phenylcyclopentyl)methyl]acetamide |
| SMILES | O=C(CSc1nnnn1C1CC1)NCC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C18H23N5OS/c24-16(12-25-17-20-21-22-23(17)15-8-9-15)19-13-18(10-4-5-11-18)14-6-2-1-3-7-14/h1-3,6-7,15H,4-5,8-13H2,(H,19,24) |
| InChIKey | GKSMBAJPOQAFMV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |