C19H25N5OS — CID 55541677
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(1-phenylcyclobutyl)methyl]acetamide (PubChem CID 55541677) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(1-phenylcyclobutyl)methyl]acetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(1-phenylcyclobutyl)methyl]acetamide |
|---|---|
| PubChem CID | 55541677 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[(1-phenylcyclobutyl)methyl]acetamide |
| SMILES | O=C(CSc1nnnn1C1CCCC1)NCC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C19H25N5OS/c25-17(13-26-18-21-22-23-24(18)16-9-4-5-10-16)20-14-19(11-6-12-19)15-7-2-1-3-8-15/h1-3,7-8,16H,4-6,9-14H2,(H,20,25) |
| InChIKey | KDEWLEOOFHZVIM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |