C22H29N5O3S — CID 55530981
2-(1-butyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 55530981) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-(1-butyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | 2-(1-butyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55530981 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-(1-butyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | CCCCn1c(SCC(=O)NN2C(=O)NC(CC)(c3ccccc3)C2=O)nc(C)c1C |
| InChI | InChI=1S/C22H29N5O3S/c1-5-7-13-26-16(4)15(3)23-21(26)31-14-18(28)25-27-19(29)22(6-2,24-20(27)30)17-11-9-8-10-12-17/h8-12H,5-7,13-14H2,1-4H3,(H,24,30)(H,25,28) |
| InChIKey | LWNWVGROAWMQRY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|