C23H24N6O3S — CID 55425463
2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 55425463) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55425463 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | CCNc1nc(SCC(=O)NN2C(=O)NC(CC)(c3ccccc3)C2=O)nc2ccccc12 |
| InChI | InChI=1S/C23H24N6O3S/c1-3-23(15-10-6-5-7-11-15)20(31)29(22(32)27-23)28-18(30)14-33-21-25-17-13-9-8-12-16(17)19(26-21)24-4-2/h5-13H,3-4,14H2,1-2H3,(H,27,32)(H,28,30)(H,24,25,26) |
| InChIKey | XEVHMNQSVROAIO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|