C17H18N4O2S — CID 17407158
2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-(furan-2-ylmethyl)acetamide (PubChem CID 17407158) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 17407158 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCNc1nc(SCC(=O)NCc2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C17H18N4O2S/c1-2-18-16-13-7-3-4-8-14(13)20-17(21-16)24-11-15(22)19-10-12-6-5-9-23-12/h3-9H,2,10-11H2,1H3,(H,19,22)(H,18,20,21) |
| InChIKey | CJOAKCONPYGGIG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |