C22H27N5O3S2 — CID 27098326
N-[4-(diethylsulfamoyl)phenyl]-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide (PubChem CID 27098326) has the molecular formula C22H27N5O3S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 27098326 |
| Molecular Formula | C22H27N5O3S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide |
| SMILES | CCNc1nc(SCC(=O)Nc2ccc(S(=O)(=O)N(CC)CC)cc2)nc2ccccc12 |
| InChI | InChI=1S/C22H27N5O3S2/c1-4-23-21-18-9-7-8-10-19(18)25-22(26-21)31-15-20(28)24-16-11-13-17(14-12-16)32(29,30)27(5-2)6-3/h7-14H,4-6,15H2,1-3H3,(H,24,28)(H,23,25,26) |
| InChIKey | BRYPCFBHNDEUIK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |