C20H24N4O3S2 — CID 4883075
N-[4-(diethylsulfamoyl)phenyl]-2-(2-methylsulfanylbenzimidazol-1-yl)acetamide (PubChem CID 4883075) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-(2-methylsulfanylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-(2-methylsulfanylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 4883075 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-(2-methylsulfanylbenzimidazol-1-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)Cn2c(SC)nc3ccccc32)cc1 |
| InChI | InChI=1S/C20H24N4O3S2/c1-4-23(5-2)29(26,27)16-12-10-15(11-13-16)21-19(25)14-24-18-9-7-6-8-17(18)22-20(24)28-3/h6-13H,4-5,14H2,1-3H3,(H,21,25) |
| InChIKey | TWCFYUHMAHAAFL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |