C17H15N5OS2 — CID 40766768
N-(3-cyanothiophen-2-yl)-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide (PubChem CID 40766768) has the molecular formula C17H15N5OS2 and a molecular weight of 369.48 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 40766768 |
| Molecular Formula | C17H15N5OS2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide |
| SMILES | CCNc1nc(SCC(=O)Nc2sccc2C#N)nc2ccccc12 |
| InChI | InChI=1S/C17H15N5OS2/c1-2-19-15-12-5-3-4-6-13(12)20-17(22-15)25-10-14(23)21-16-11(9-18)7-8-24-16/h3-8H,2,10H2,1H3,(H,21,23)(H,19,20,22) |
| InChIKey | RFGUKPWPADQYHU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |