C19H23N5OS — CID 27108470
N-(1-cyanocyclohexyl)-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide (PubChem CID 27108470) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 27108470 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[4-(ethylamino)quinazolin-2-yl]sulfanylacetamide |
| SMILES | CCNc1nc(SCC(=O)NC2(C#N)CCCCC2)nc2ccccc12 |
| InChI | InChI=1S/C19H23N5OS/c1-2-21-17-14-8-4-5-9-15(14)22-18(23-17)26-12-16(25)24-19(13-20)10-6-3-7-11-19/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | JNSYEUIOFHGYBZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |