C20H26N4OS — CID 4819556
N-(1-cyanocyclohexyl)-2-[1-(2-methylpropyl)benzimidazol-2-yl]sulfanylacetamide (PubChem CID 4819556) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[1-(2-methylpropyl)benzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[1-(2-methylpropyl)benzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4819556 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[1-(2-methylpropyl)benzimidazol-2-yl]sulfanylacetamide |
| SMILES | CC(C)Cn1c(SCC(=O)NC2(C#N)CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C20H26N4OS/c1-15(2)12-24-17-9-5-4-8-16(17)22-19(24)26-13-18(25)23-20(14-21)10-6-3-7-11-20/h4-5,8-9,15H,3,6-7,10-13H2,1-2H3,(H,23,25) |
| InChIKey | DJFOHOXAEKQHND-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |