C23H21FN4O2S — CID 4819488
N-(1-cyanocyclohexyl)-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 4819488) has the molecular formula C23H21FN4O2S and a molecular weight of 436.51 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4819488 |
| Molecular Formula | C23H21FN4O2S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | N#CC1(NC(=O)CSc2nc3ccccc3c(=O)n2-c2ccccc2F)CCCCC1 |
| InChI | InChI=1S/C23H21FN4O2S/c24-17-9-3-5-11-19(17)28-21(30)16-8-2-4-10-18(16)26-22(28)31-14-20(29)27-23(15-25)12-6-1-7-13-23/h2-5,8-11H,1,6-7,12-14H2,(H,27,29) |
| InChIKey | WCRKJLAEEWDZNI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |