C20H23F3N4OS — CID 18282974
N-(1-cyanocyclohexyl)-2-[1-propyl-6-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetamide (PubChem CID 18282974) has the molecular formula C20H23F3N4OS and a molecular weight of 424.49 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[1-propyl-6-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[1-propyl-6-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 18282974 |
| Molecular Formula | C20H23F3N4OS |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[1-propyl-6-(trifluoromethyl)benzimidazol-2-yl]sulfanylacetamide |
| SMILES | CCCn1c(SCC(=O)NC2(C#N)CCCCC2)nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C20H23F3N4OS/c1-2-10-27-16-11-14(20(21,22)23)6-7-15(16)25-18(27)29-12-17(28)26-19(13-24)8-4-3-5-9-19/h6-7,11H,2-5,8-10,12H2,1H3,(H,26,28) |
| InChIKey | JDXULPQWFXBXAP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |