C19H21ClN4O2S — CID 7428048
2-(7-chloro-4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-(1-cyanocyclopentyl)acetamide (PubChem CID 7428048) has the molecular formula C19H21ClN4O2S and a molecular weight of 404.92 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-(1-cyanocyclopentyl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-(1-cyanocyclopentyl)acetamide |
|---|---|
| PubChem CID | 7428048 |
| Molecular Formula | C19H21ClN4O2S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-(1-cyanocyclopentyl)acetamide |
| SMILES | CC(C)n1c(SCC(=O)NC2(C#N)CCCC2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H21ClN4O2S/c1-12(2)24-17(26)14-6-5-13(20)9-15(14)22-18(24)27-10-16(25)23-19(11-21)7-3-4-8-19/h5-6,9,12H,3-4,7-8,10H2,1-2H3,(H,23,25) |
| InChIKey | JLPJBEXCJQQKEL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |