C17H16ClN3O2S — CID 7427979
7-chloro-2-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]sulfanyl-3-propan-2-ylquinazolin-4-one (PubChem CID 7427979) has the molecular formula C17H16ClN3O2S and a molecular weight of 361.85 g/mol. Its IUPAC name is 7-chloro-2-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]sulfanyl-3-propan-2-ylquinazolin-4-one.
| Compound Name | 7-chloro-2-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]sulfanyl-3-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 7427979 |
| Molecular Formula | C17H16ClN3O2S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 7-chloro-2-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]sulfanyl-3-propan-2-ylquinazolin-4-one |
| SMILES | CC(C)n1c(SCC(=O)c2ccc[nH]2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C17H16ClN3O2S/c1-10(2)21-16(23)12-6-5-11(18)8-14(12)20-17(21)24-9-15(22)13-4-3-7-19-13/h3-8,10,19H,9H2,1-2H3 |
| InChIKey | VTNSOBOFDXMDMU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |