C11H8ClN2O3S- — CID 7174444
2-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate (PubChem CID 7174444) has the molecular formula C11H8ClN2O3S- and a molecular weight of 283.72 g/mol. Its IUPAC name is 2-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate.
| Compound Name | 2-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7174444 |
| Molecular Formula | C11H8ClN2O3S- |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 2-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate |
| SMILES | Cn1c(SCC(=O)[O-])nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C11H9ClN2O3S/c1-14-10(17)7-3-2-6(12)4-8(7)13-11(14)18-5-9(15)16/h2-4H,5H2,1H3,(H,15,16)/p-1 |
| InChIKey | ZILBUEJATAWVCD-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |