C11H7Cl2N2O3S- — CID 7174436
2-(6,8-dichloro-3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate (PubChem CID 7174436) has the molecular formula C11H7Cl2N2O3S- and a molecular weight of 318.16 g/mol. Its IUPAC name is 2-(6,8-dichloro-3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate.
| Compound Name | 2-(6,8-dichloro-3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7174436 |
| Molecular Formula | C11H7Cl2N2O3S- |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 316.96 |
| IUPAC Name | 2-(6,8-dichloro-3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate |
| SMILES | Cn1c(SCC(=O)[O-])nc2c(Cl)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C11H8Cl2N2O3S/c1-15-10(18)6-2-5(12)3-7(13)9(6)14-11(15)19-4-8(16)17/h2-3H,4H2,1H3,(H,16,17)/p-1 |
| InChIKey | ODELGGDXVAUUBT-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |