C12H9Br2N2O3S- — CID 7174426
2-(6,8-dibromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetate (PubChem CID 7174426) has the molecular formula C12H9Br2N2O3S- and a molecular weight of 421.09 g/mol. Its IUPAC name is 2-(6,8-dibromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetate.
| Compound Name | 2-(6,8-dibromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7174426 |
| Molecular Formula | C12H9Br2N2O3S- |
| Molecular Weight | 421.09 g/mol |
| Exact Mass | 418.87 |
| IUPAC Name | 2-(6,8-dibromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetate |
| SMILES | CCn1c(SCC(=O)[O-])nc2c(Br)cc(Br)cc2c1=O |
| InChI | InChI=1S/C12H10Br2N2O3S/c1-2-16-11(19)7-3-6(13)4-8(14)10(7)15-12(16)20-5-9(17)18/h3-4H,2,5H2,1H3,(H,17,18)/p-1 |
| InChIKey | UALNVUDNLMYZJW-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.09 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |